Products 1228670-37-8
CAS 1228670-37-8 is the registry number for (Z)-5-(Benzyloxy)-6-bromopicolinaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(NZ)-N-[(6-bromo-5-phenylmethoxy-2-pyridinyl)methylidene]hydroxylamine (CAS 1228670-37-8) is a chemical compound with the molecular formula C13H11BrN2O2 and a molecular weight of 307.14 g/mol. IUPAC name: (NZ)-N-[(6-bromo-5-phenylmethoxy-2-pyridinyl)methylidene]hydroxylamine. InChIKey: PBYXJLWMHLTXTB-NVNXTCNLSA-N.
| Molecular formula | C13H11BrN2O2 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | (NZ)-N-[(6-bromo-5-phenylmethoxy-2-pyridinyl)methylidene]hydroxylamine |
| InChIKey | PBYXJLWMHLTXTB-NVNXTCNLSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=C(C=C2)/C=N\O)Br |
Computed by PubChem (NCBI)