CAS 1150271-15-0 appears in our catalog under these names: N-Benzyl 2-bromo-4-nitroaniline, 98%, N-Benzyl-2-bromo-4-nitroaniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
N-benzyl-2-bromo-4-nitroaniline (CAS 1150271-15-0) is a chemical compound with the molecular formula C13H11BrN2O2 and a molecular weight of 307.14 g/mol. IUPAC name: N-benzyl-2-bromo-4-nitroaniline. InChIKey: KFZNBRDIUGUIKO-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O2 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | N-benzyl-2-bromo-4-nitroaniline |
| InChIKey | KFZNBRDIUGUIKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=C(C=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)