Products 1415719-05-9
CAS 1415719-05-9 is the registry number for 1-(4-Bromophenyl)-3-(prop-2-yn-1-ylamino)pyrrolidine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(4-bromophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione (CAS 1415719-05-9) is a chemical compound with the molecular formula C13H11BrN2O2 and a molecular weight of 307.14 g/mol. IUPAC name: 1-(4-bromophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione. InChIKey: QKRHYZYBAVDFHS-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O2 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione |
| InChIKey | QKRHYZYBAVDFHS-UHFFFAOYSA-N |
| SMILES | C#CCNC1CC(=O)N(C1=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)