cas: 916210-27-0 — see every product listed under this CAS number, including other names
Carbamic acid, N-[(2-chloro-4-pyridinyl)methyl]-, 1,1-dimethylethyl ester, 97%, 97% (CAS 916210-27-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H3UR-100mg |
| cas | 916210-27-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 558.80 Pln | |
| Chemat | 1g | 746.00 Pln | |
| Chemat | 5g | 2459.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2-chloro-4-pyridinyl)methyl]carbamate (CAS 916210-27-0) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: tert-butyl N-[(2-chloro-4-pyridinyl)methyl]carbamate. InChIKey: UZBMRJZJIUFSNU-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | tert-butyl N-[(2-chloro-4-pyridinyl)methyl]carbamate |
| InChIKey | UZBMRJZJIUFSNU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=NC=C1)Cl |
Computed by PubChem (NCBI)