Products 15952-20-2

CAS 15952-20-2 is the registry number for 6-Chloro-2-phenyl-1,3-benzoxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

6-chloro-2-phenyl-1,3-benzoxazole (CAS 15952-20-2) is a chemical compound with the molecular formula C13H8ClNO and a molecular weight of 229.66 g/mol. IUPAC name: 6-chloro-2-phenyl-1,3-benzoxazole. InChIKey: KAOOHHSDVVRTDG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8ClNO
Molecular weight229.66 g/mol
IUPAC name6-chloro-2-phenyl-1,3-benzoxazole
InChIKeyKAOOHHSDVVRTDG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC3=C(O2)C=C(C=C3)Cl

Computed by PubChem (NCBI)