CAS 69220-40-2 appears in our catalog under these names: 4-Chloroacridin-9(10H)-one, 4–Chloroacridin–9(10H)–one. Offered by: TRC, GLPBio. Available pack sizes: 500mg, 100mg, 250mg.
4-chloro-10H-acridin-9-one (CAS 69220-40-2) is a chemical compound with the molecular formula C13H8ClNO and a molecular weight of 229.66 g/mol. IUPAC name: 4-chloro-10H-acridin-9-one. InChIKey: UNFRCVRJLUPLIP-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 4-chloro-10H-acridin-9-one |
| InChIKey | UNFRCVRJLUPLIP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(N2)C(=CC=C3)Cl |
Computed by PubChem (NCBI)