CAS 159138-80-4 appears in our catalog under these names: Cariporide, Cariporide/ 97.41% (existing batch purity), Cariporide, >95.0%(HPLC)(qNMR), Cariporide 97%, N-(Aminoiminomethyl)-4-(1-methylethyl)-3-(methylsulfonyl)benzamide, 97%, 97%. Offered by: TRC, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
N-(diaminomethylidene)-3-methylsulfonyl-4-propan-2-ylbenzamide (CAS 159138-80-4) is a chemical compound with the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. IUPAC name: N-(diaminomethylidene)-3-methylsulfonyl-4-propan-2-ylbenzamide. InChIKey: IWXNYAIICFKCTM-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O3S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | N-(diaminomethylidene)-3-methylsulfonyl-4-propan-2-ylbenzamide |
| InChIKey | IWXNYAIICFKCTM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1)C(=O)N=C(N)N)S(=O)(=O)C |
Computed by PubChem (NCBI)