Products 1139-30-6
CAS 1139-30-6 appears in our catalog under these names: Caryophyllene Oxide 1000 µg/mL in Isopropanol, b-Caryophyllene Epoxide, >95% (HPLC), beta-Caryophyllene Epoxide, >95% (HPLC), Caryophyllene oxide/ 99.71% (existing batch purity), (–)–Caryophyllene oxide. Offered by: Dr. Ehrenstorfer, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 1ml, 10g, 1g, 25g, 100mg, 0,1kg, 0,05kg, 50g.
(1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecane (CAS 1139-30-6) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecane. InChIKey: NVEQFIOZRFFVFW-RGCMKSIDSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecane |
| InChIKey | NVEQFIOZRFFVFW-RGCMKSIDSA-N |
| SMILES | C[C@@]12CC[C@@H]3[C@H](CC3(C)C)C(=C)CC[C@H]1O2 |
Computed by PubChem (NCBI)
Synonyms:
Caryophyllene oxide, beta-Caryophyllene oxide, Caryophylene oxide, Epoxycaryophyllene, trans-caryophyllene oxide, (-)-BETA-CARYOPHYLLENE EPOXIDE, (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecane, (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo(8.2.0.04,6)dodecane, (-)-Caryophyllene oxide, (-)Carophyllene oxide