cas: 61425-27-2 — see every product listed under this CAS number, including other names
Cbz-D-Alaninol 97% (CAS 61425-27-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A477093-1g |
| cas | 61425-27-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 10g | 153.44 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 882.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A477093 |
Benzyl N-[(2R)-1-hydroxypropan-2-yl]carbamate (CAS 61425-27-2) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: benzyl N-[(2R)-1-hydroxypropan-2-yl]carbamate. InChIKey: AFPHMHSLDRPUSM-SECBINFHSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | benzyl N-[(2R)-1-hydroxypropan-2-yl]carbamate |
| InChIKey | AFPHMHSLDRPUSM-SECBINFHSA-N |
| SMILES | C[C@H](CO)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)