CAS 2386-32-5 is the registry number for Ethyl 3-acetyl-4,5-dimethyl-1h-pyrrole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Ethyl 3-acetyl-4,5-dimethyl-1H-pyrrole-2-carboxylate (CAS 2386-32-5) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: ethyl 3-acetyl-4,5-dimethyl-1H-pyrrole-2-carboxylate. InChIKey: BFCCFLZRLLFPRR-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | ethyl 3-acetyl-4,5-dimethyl-1H-pyrrole-2-carboxylate |
| InChIKey | BFCCFLZRLLFPRR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N1)C)C)C(=O)C |
Computed by PubChem (NCBI)