CAS 72155-50-1 is the registry number for (3S,4S)-4-Amino-3-hydroxy-5-phenylpentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
(3S,4S)-4-amino-3-hydroxy-5-phenylpentanoic acid (CAS 72155-50-1) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (3S,4S)-4-amino-3-hydroxy-5-phenylpentanoic acid. InChIKey: JAJQQUQHMLWDFB-UWVGGRQHSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (3S,4S)-4-amino-3-hydroxy-5-phenylpentanoic acid |
| InChIKey | JAJQQUQHMLWDFB-UWVGGRQHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H]([C@H](CC(=O)O)O)N |
Computed by PubChem (NCBI)