CAS 1218078-20-6 appears in our catalog under these names: Methyl 2-amino-2-(4-hydroxy-3,5-dimethylphenyl)acetate, 95%, Methyl 2-amino-2-(4-hydroxy-3,5-dimethylphenyl)acetate, 97%, Methyl 2-amino-2-(4-hydroxy-3,5-dimethylphenyl)acetate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
Methyl 2-amino-2-(4-hydroxy-3,5-dimethylphenyl)acetate (CAS 1218078-20-6) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: methyl 2-amino-2-(4-hydroxy-3,5-dimethylphenyl)acetate. InChIKey: VSLJXBAAQCDZDY-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | methyl 2-amino-2-(4-hydroxy-3,5-dimethylphenyl)acetate |
| InChIKey | VSLJXBAAQCDZDY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)C(C(=O)OC)N |
Computed by PubChem (NCBI)