cas: 2389-49-3 — see every product listed under this CAS number, including other names
Cbz-Lys(Boc)-OMe 98% (CAS 2389-49-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A487653-1g |
| cas | 2389-49-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 25g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A487653 |
Methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate (CAS 2389-49-3) is a chemical compound with the molecular formula C20H30N2O6 and a molecular weight of 394.5 g/mol. IUPAC name: methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate. InChIKey: ZJWQKFBUQSKZOS-INIZCTEOSA-N.
| Molecular formula | C20H30N2O6 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate |
| InChIKey | ZJWQKFBUQSKZOS-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)