Cbz-Pro-Pro-OH 97%
cas: 7360-23-8 — see every product listed under this CAS number, including other names
Cbz-Pro-Pro-OH 97% (CAS 7360-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A101916-1g |
| cas | 7360-23-8 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 587.31 Pln | |
| Ambeed | 10g | 921.06 Pln | |
| Ambeed | 25g | 1766.56 Pln | |
| Ambeed | 100g | 4686.88 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A101916 |
1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid (CAS 7360-23-8) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: 1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid. InChIKey: GEAZFVPWHCGNLW-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | GEAZFVPWHCGNLW-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)C2CCCN2C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)