Z-Pro-Pro-OH, 97%, 97%
cas: 7360-23-8 — see every product listed under this CAS number, including other names
Z-Pro-Pro-OH, 97%, 97% (CAS 7360-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FCSH-1g |
| cas | 7360-23-8 |
| size | 1g |
| availability | 35g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Chemat | 10g | 1072.40 Pln | |
| Chemat | 25g | 2080.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid (CAS 7360-23-8) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: 1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid. InChIKey: GEAZFVPWHCGNLW-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | GEAZFVPWHCGNLW-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)C2CCCN2C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)