Products 121104-96-9
CAS 121104-96-9 appears in our catalog under these names: Celgosivir, >95% (HPLC), Celgosivir/ 98.03% (existing batch purity), Celgosivir (MBI 3253), Celgosivir, Celgosivir, min. 95 %, 1 mg. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 25mg, 5mg, 1mg, 2mg, 10mg, 50mg, 500mg.
[(1S,6S,7S,8R,8aR)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] butanoate (CAS 121104-96-9) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: [(1S,6S,7S,8R,8aR)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] butanoate. InChIKey: HTJGLYIJVSDQAE-VWNXEWBOSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | [(1S,6S,7S,8R,8aR)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] butanoate |
| InChIKey | HTJGLYIJVSDQAE-VWNXEWBOSA-N |
| SMILES | CCCC(=O)O[C@H]1CN2CC[C@@H]([C@@H]2[C@H]([C@@H]1O)O)O |
Computed by PubChem (NCBI)