CAS 1402830-75-4 appears in our catalog under these names: 3-((2E)-3-(4-Methoxyphenyl)prop-2-enoyl)-4-phenyl-1,2-dihydroquinolin-2-one, Ceranib-2/ 97.49% (existing batch purity), Ceranib–2, Ceranib-2, 98.49% ,, 98.49% ,, Ceranib-2, 98.92%. Offered by: Biosynth, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 200mg, 100 mg.
3-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one (CAS 1402830-75-4) is a chemical compound with the molecular formula C25H19NO3 and a molecular weight of 381.4 g/mol. IUPAC name: 3-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one. InChIKey: YIJGNIIQDRGGFT-DTQAZKPQSA-N.
| Molecular formula | C25H19NO3 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | 3-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
| InChIKey | YIJGNIIQDRGGFT-DTQAZKPQSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)C2=C(C3=CC=CC=C3NC2=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)