CAS 3114-55-4 appears in our catalog under these names: Chlorobenzene D5, Chlorobenzene D5 100 µg/mL in Methanol, Chlorobenzene-d5 (Reagent grade), 99 atom % D, min 99% Chemical Purity, Chlorobenzene-d{5}, 99% (Isotopic) , Chlorobenzene-D5 99 atom % D. Offered by: Dr. Ehrenstorfer, CDN, Thermo Scientific (Alfa Aesar), Deutero, Biosynth. Available pack sizes: 500mg, 1ml, 5g, 0,7ml, 5ml, 2g, 1g, 10g.
1-chloro-2,3,4,5,6-pentadeuteriobenzene (CAS 3114-55-4) is a chemical compound with the molecular formula C6H5Cl and a molecular weight of 117.59 g/mol. IUPAC name: 1-chloro-2,3,4,5,6-pentadeuteriobenzene. InChIKey: MVPPADPHJFYWMZ-RALIUCGRSA-N.
| Molecular formula | C6H5Cl |
|---|---|
| Molecular weight | 117.59 g/mol |
| IUPAC name | 1-chloro-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | MVPPADPHJFYWMZ-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])Cl)[2H])[2H] |
Computed by PubChem (NCBI)