Products 59164-10-2
CAS 59164-10-2 is the registry number for Chlorobenzene-3,5-d2, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1-chloro-3,5-dideuteriobenzene (CAS 59164-10-2) is a chemical compound with the molecular formula C6H5Cl and a molecular weight of 114.57 g/mol. IUPAC name: 1-chloro-3,5-dideuteriobenzene. InChIKey: MVPPADPHJFYWMZ-PBNXXWCMSA-N.
| Molecular formula | C6H5Cl |
|---|---|
| Molecular weight | 114.57 g/mol |
| IUPAC name | 1-chloro-3,5-dideuteriobenzene |
| InChIKey | MVPPADPHJFYWMZ-PBNXXWCMSA-N |
| SMILES | [2H]C1=CC(=CC(=C1)Cl)[2H] |
Computed by PubChem (NCBI)