Products 59164-10-2

CAS 59164-10-2 is the registry number for Chlorobenzene-3,5-d2, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

1-chloro-3,5-dideuteriobenzene (CAS 59164-10-2) is a chemical compound with the molecular formula C6H5Cl and a molecular weight of 114.57 g/mol. IUPAC name: 1-chloro-3,5-dideuteriobenzene. InChIKey: MVPPADPHJFYWMZ-PBNXXWCMSA-N.

Identity
Molecular formulaC6H5Cl
Molecular weight114.57 g/mol
IUPAC name1-chloro-3,5-dideuteriobenzene
InChIKeyMVPPADPHJFYWMZ-PBNXXWCMSA-N
SMILES[2H]C1=CC(=CC(=C1)Cl)[2H]

Computed by PubChem (NCBI)