Products 13122-34-4

CAS 13122-34-4 is the registry number for Chlorobenzene-4-d1, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1-chloro-4-deuteriobenzene (CAS 13122-34-4) is a chemical compound with the molecular formula C6H5Cl and a molecular weight of 113.56 g/mol. IUPAC name: 1-chloro-4-deuteriobenzene. InChIKey: MVPPADPHJFYWMZ-MICDWDOJSA-N.

Identity
Molecular formulaC6H5Cl
Molecular weight113.56 g/mol
IUPAC name1-chloro-4-deuteriobenzene
InChIKeyMVPPADPHJFYWMZ-MICDWDOJSA-N
SMILES[2H]C1=CC=C(C=C1)Cl

Computed by PubChem (NCBI)