CAS 287389-52-0 appears in our catalog under these names: Chlorobenzene-13C6, >95% (HPLC), CHLOROBENZENE-13C6, 99 ATOM % 13C. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 100mg, 500mg.
Chloro(1,2,3,4,5,6-13C6)cyclohexatriene (CAS 287389-52-0) is a chemical compound with the molecular formula C6H5Cl and a molecular weight of 118.51 g/mol. IUPAC name: chloro(1,2,3,4,5,6-13C6)cyclohexatriene. InChIKey: MVPPADPHJFYWMZ-IDEBNGHGSA-N.
| Molecular formula | C6H5Cl |
|---|---|
| Molecular weight | 118.51 g/mol |
| IUPAC name | chloro(1,2,3,4,5,6-13C6)cyclohexatriene |
| InChIKey | MVPPADPHJFYWMZ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)Cl |
Computed by PubChem (NCBI)