CAS 1637741-58-2 appears in our catalog under these names: Cipepofol, 98%, Cipepofol/ 99.77% (existing batch purity), Cipepofol, Cipepofol, 98%, 98%, Cipepofol, 99.82%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 10mM (in 1ml dmso), 25 mg.
2-[(1R)-1-cyclopropylethyl]-6-propan-2-ylphenol (CAS 1637741-58-2) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 2-[(1R)-1-cyclopropylethyl]-6-propan-2-ylphenol. InChIKey: BMEARIQHWSVDBS-SNVBAGLBSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 2-[(1R)-1-cyclopropylethyl]-6-propan-2-ylphenol |
| InChIKey | BMEARIQHWSVDBS-SNVBAGLBSA-N |
| SMILES | C[C@H](C1CC1)C2=CC=CC(=C2O)C(C)C |
Computed by PubChem (NCBI)