cas: 7389-38-0 — see every product listed under this CAS number, including other names
Cirsiumaldehyde, 99.89% (CAS 7389-38-0) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10mM/1mL, 10 g, 1 g, 25 g, 100 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W357642-5 g |
| cas | 7389-38-0 |
| size | 5 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 477.59 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 10 g | 658.70 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 25 g | 1197.41 Pln | |
| MedChemExpress | 100 g | 3612.29 Pln | |
| MedChemExpress | 50 g | 2061.19 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.89% |
5-[(5-formylfuran-2-yl)methoxymethyl]furan-2-carbaldehyde (CAS 7389-38-0) is a chemical compound with the molecular formula C12H10O5 and a molecular weight of 234.20 g/mol. IUPAC name: 5-[(5-formylfuran-2-yl)methoxymethyl]furan-2-carbaldehyde. InChIKey: TZTWOBUHCLWLNK-UHFFFAOYSA-N.
| Molecular formula | C12H10O5 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 5-[(5-formylfuran-2-yl)methoxymethyl]furan-2-carbaldehyde |
| InChIKey | TZTWOBUHCLWLNK-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C=O)COCC2=CC=C(O2)C=O |
Computed by PubChem (NCBI)