CAS 1084-45-3 is the registry number for Ethyl 7-hydroxycoumarin-4-carboxylate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g.
Ethyl 7-hydroxy-2-oxochromene-4-carboxylate (CAS 1084-45-3) is a chemical compound with the molecular formula C12H10O5 and a molecular weight of 234.20 g/mol. IUPAC name: ethyl 7-hydroxy-2-oxochromene-4-carboxylate. InChIKey: SNMUERBNQDOIQB-UHFFFAOYSA-N.
| Molecular formula | C12H10O5 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | ethyl 7-hydroxy-2-oxochromene-4-carboxylate |
| InChIKey | SNMUERBNQDOIQB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=O)OC2=C1C=CC(=C2)O |
Computed by PubChem (NCBI)