Products 304889-93-8

CAS 304889-93-8 is the registry number for 2-[(2-Oxo-2h-chromen-7-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2-oxochromen-7-yl)oxypropanoic acid (CAS 304889-93-8) is a chemical compound with the molecular formula C12H10O5 and a molecular weight of 234.20 g/mol. IUPAC name: 2-(2-oxochromen-7-yl)oxypropanoic acid. InChIKey: IUZWIMVGNUDMDH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O5
Molecular weight234.20 g/mol
IUPAC name2-(2-oxochromen-7-yl)oxypropanoic acid
InChIKeyIUZWIMVGNUDMDH-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=CC2=C(C=C1)C=CC(=O)O2

Computed by PubChem (NCBI)