Products 2309449-62-3
CAS 2309449-62-3 is the registry number for 2-Methylfuran-3-carbonyl 2-methylfuran-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(2-methylfuran-3-carbonyl) 2-methylfuran-3-carboxylate (CAS 2309449-62-3) is a chemical compound with the molecular formula C12H10O5 and a molecular weight of 234.20 g/mol. IUPAC name: (2-methylfuran-3-carbonyl) 2-methylfuran-3-carboxylate. InChIKey: NXMRSBAZKUZGQX-UHFFFAOYSA-N.
| Molecular formula | C12H10O5 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | (2-methylfuran-3-carbonyl) 2-methylfuran-3-carboxylate |
| InChIKey | NXMRSBAZKUZGQX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CO1)C(=O)OC(=O)C2=C(OC=C2)C |
Computed by PubChem (NCBI)