Coumarin334, 98%, 98%
cas: 55804-67-6 — see every product listed under this CAS number, including other names
Coumarin334, 98%, 98% (CAS 55804-67-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114P3O-100mg |
| cas | 55804-67-6 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 500mg | 544.40 Pln | |
| Chemat | 1g | 904.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-acetyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (CAS 55804-67-6) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: 5-acetyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one. InChIKey: JBPCDMSEJVCNGV-UHFFFAOYSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 5-acetyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| InChIKey | JBPCDMSEJVCNGV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=CC3=C4C(=C2OC1=O)CCCN4CCC3 |
Computed by PubChem (NCBI)
Synonyms:
Coumarin 334, Coumarin 521, 10-Acetyl-2,3,6,7-tetrahydro-1H,5H,11H-(1)benzopyrano(6,7,8-ij)quinolizin-11-one, 10-acetyl-2,3,6,7-tetrahydro-1H,5H,11H-[1]benzopyrano[6,7,8-ij]quinolizin-11-one, Coumarin334, 10-acetyl-2,3,6,7-tetrahydro-1H-pyrano[2,3-f]pyrido[3,2,1-ij]quinolin-11(5H)-one, coumarin-334, Coumarine 334, Coumarin 334, Dye content 99 %, 3-Acetyl-6,7,9,10-tetrahydro-8H,11H-quinolizino[9,9a, 1-gh]coumarin