CAS 1160264-13-0 appears in our catalog under these names: 1-Methyl-2-(4-methylphenyl)-2-oxoethyl 4-aminobenzoate, 95%, 1-Oxo-1-(p-tolyl)propan-2-yl 4-aminobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[1-(4-methylphenyl)-1-oxopropan-2-yl] 4-aminobenzoate (CAS 1160264-13-0) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: [1-(4-methylphenyl)-1-oxopropan-2-yl] 4-aminobenzoate. InChIKey: IQKYKZPHTUXGGU-UHFFFAOYSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 4-aminobenzoate |
| InChIKey | IQKYKZPHTUXGGU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(C)OC(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)