CAS 1092788-87-8 appears in our catalog under these names: pCDPK1/TgCDPK1-IN-3/ 99.08% (existing batch purity), CpCDPK1/TgCDPK1–IN–3, 1-(1-Methylethyl)-3-(1-methyl-1H-indol-5-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine, 99.63% ,, 99.63% ,, CpCDPK1/TgCDPK1-IN-3. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
3-(1-methylindol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 1092788-87-8) is a chemical compound with the molecular formula C17H18N6 and a molecular weight of 306.4 g/mol. IUPAC name: 3-(1-methylindol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: SPUWUOGLPPVXCW-UHFFFAOYSA-N.
| Molecular formula | C17H18N6 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 3-(1-methylindol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | SPUWUOGLPPVXCW-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=NC=NC(=C2C(=N1)C3=CC4=C(C=C3)N(C=C4)C)N |
Computed by PubChem (NCBI)