Products 1236038-23-5
CAS 1236038-23-5 appears in our catalog under these names: CpCDPK1/TgCDPK1-IN-2/ 99.8% (existing batch purity), CpCDPK1/TgCDPK1-IN-2. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
3-(6-ethoxynaphthalen-2-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 1236038-23-5) is a chemical compound with the molecular formula C20H21N5O and a molecular weight of 347.4 g/mol. IUPAC name: 3-(6-ethoxynaphthalen-2-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: MJOCJDMQRCJQJF-UHFFFAOYSA-N.
| Molecular formula | C20H21N5O |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 3-(6-ethoxynaphthalen-2-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | MJOCJDMQRCJQJF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C=C(C=C2)C3=NN(C4=NC=NC(=C34)N)C(C)C |
Computed by PubChem (NCBI)