cas: 1104637-37-7 — see every product listed under this CAS number, including other names
Cyclobutylboronic acid MIDA ester, 97%, 97% (CAS 1104637-37-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114P4X-250mg |
| cas | 1104637-37-7 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 381.20 Pln | |
| Chemat | 5g | 1178.00 Pln | |
| Chemat | 25g | 3851.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-cyclobutyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1104637-37-7) is a chemical compound with the molecular formula C9H14BNO4 and a molecular weight of 211.03 g/mol. IUPAC name: 2-cyclobutyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: FRGMPYGRMJGPAV-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4 |
|---|---|
| Molecular weight | 211.03 g/mol |
| IUPAC name | 2-cyclobutyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | FRGMPYGRMJGPAV-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2CCC2 |
Computed by PubChem (NCBI)