CAS 832697-40-2 appears in our catalog under these names: 1-(tert-Butoxycarbonyl)pyrrole-3-boronic acid, 98%, (1-(tert-Butoxycarbonyl)-1H-pyrrol-3-yl)boronic acid 98%, 1-Boc-1H-pyrrole-3-boronic Acid, 98%, 98%, (1-(Tert-butoxycarbonyl)-1H-pyrrol-3-yl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-3-yl]boronic acid (CAS 832697-40-2) is a chemical compound with the molecular formula C9H14BNO4 and a molecular weight of 211.03 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-3-yl]boronic acid. InChIKey: JTFQDOHHXGSMFC-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4 |
|---|---|
| Molecular weight | 211.03 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-3-yl]boronic acid |
| InChIKey | JTFQDOHHXGSMFC-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C=C1)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)