Products 1003043-46-6

CAS 1003043-46-6 appears in our catalog under these names: 2,6-Diethoxypyridine-3-boronic acid, 97%, (2,6-Diethoxypyridin-3-yl)boronic acid, 95+%, (2,6-Diethoxypyridin-3-yl)boronic acid, ≥95%, ≥95%, 2,6-Diethoxypyridine-3-boronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(2,6-diethoxy-3-pyridinyl)boronic acid (CAS 1003043-46-6) is a chemical compound with the molecular formula C9H14BNO4 and a molecular weight of 211.03 g/mol. IUPAC name: (2,6-diethoxy-3-pyridinyl)boronic acid. InChIKey: HTELBRAIBMTDOF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14BNO4
Molecular weight211.03 g/mol
IUPAC name(2,6-diethoxy-3-pyridinyl)boronic acid
InChIKeyHTELBRAIBMTDOF-UHFFFAOYSA-N
SMILESB(C1=C(N=C(C=C1)OCC)OCC)(O)O

Computed by PubChem (NCBI)