CAS 135884-31-0 appears in our catalog under these names: 1-BOC-pyrrole-2-boronic acid, 98%, 1–Boc–2–pyrroleboronic Acid (contains varying amounts of Anhydride), 1-(tert-Butoxycarbonyl)-2-pyrroleboronic Acid (contains varying amounts of Anhydride), N-Boc-pyrroyl-boronic acid, N-Boc-2-pyrroleboronic acid 98%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 5g, 25g, 100g, 500g, 1g, 50g, 250g, 10g.
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-2-yl]boronic acid (CAS 135884-31-0) is a chemical compound with the molecular formula C9H14BNO4 and a molecular weight of 211.03 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-2-yl]boronic acid. InChIKey: ZWGMJLNXIVRFRJ-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4 |
|---|---|
| Molecular weight | 211.03 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-2-yl]boronic acid |
| InChIKey | ZWGMJLNXIVRFRJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CN1C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)