Cyclohexanehexone 95% (contains 40-44%Water)
cas: 527-31-1 — see every product listed under this CAS number, including other names
Cyclohexanehexone 95% (contains 40-44%Water) (CAS 527-31-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1504594-1g |
| cas | 527-31-1 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 470.50 Pln | |
| Ambeed | 100g | 1160.25 Pln |
properties
| purity | 95% (contains 40-44%Water) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1504594 |
Cyclohexane-1,2,3,4,5,6-hexone (CAS 527-31-1) is a chemical compound with the molecular formula C6O6 and a molecular weight of 168.06 g/mol. IUPAC name: cyclohexane-1,2,3,4,5,6-hexone. InChIKey: PKRGYJHUXHCUCN-UHFFFAOYSA-N.
| Molecular formula | C6O6 |
|---|---|
| Molecular weight | 168.06 g/mol |
| IUPAC name | cyclohexane-1,2,3,4,5,6-hexone |
| InChIKey | PKRGYJHUXHCUCN-UHFFFAOYSA-N |
| SMILES | C1(=O)C(=O)C(=O)C(=O)C(=O)C1=O |
Computed by PubChem (NCBI)