cas: 145591-80-6 — see every product listed under this CAS number, including other names
Cyclopropanecarboxylic acid, 1-[(phenylamino)carbonyl]-, 95%, 95% (CAS 145591-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ABJO-100mg |
| cas | 145591-80-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1197.20 Pln | |
| Chemat | 1g | 2718.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(phenylcarbamoyl)cyclopropane-1-carboxylic acid (CAS 145591-80-6) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 1-(phenylcarbamoyl)cyclopropane-1-carboxylic acid. InChIKey: KDXROTVXLGAFGW-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 1-(phenylcarbamoyl)cyclopropane-1-carboxylic acid |
| InChIKey | KDXROTVXLGAFGW-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)