cas: 2055841-07-9 — see every product listed under this CAS number, including other names
Cyclopropanecarboxylic acid, 2-(4-chloro-3-fluorophenyl)-, (1R,2R)-rel-, 97%, 97% (CAS 2055841-07-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113A97-100mg |
| cas | 2055841-07-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 500mg | 698.00 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 2882.00 Pln | |
| Chemat | 10g | 4758.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 2055841-07-9) is a chemical compound with the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. IUPAC name: trans-(1R,2R)-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: WLBMRAWVMMPUAI-NKWVEPMBSA-N.
| Molecular formula | C10H8ClFO2 |
|---|---|
| Molecular weight | 214.62 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WLBMRAWVMMPUAI-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)