Products 1000052-58-3
CAS 1000052-58-3 is the registry number for Methyl (2e)-3-(4-chloro-2-fluorophenyl)prop-2-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl (E)-3-(4-chloro-2-fluorophenyl)prop-2-enoate (CAS 1000052-58-3) is a chemical compound with the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. IUPAC name: methyl (E)-3-(4-chloro-2-fluorophenyl)prop-2-enoate. InChIKey: OCGRVPULGVALNH-HWKANZROSA-N.
| Molecular formula | C10H8ClFO2 |
|---|---|
| Molecular weight | 214.62 g/mol |
| IUPAC name | methyl (E)-3-(4-chloro-2-fluorophenyl)prop-2-enoate |
| InChIKey | OCGRVPULGVALNH-HWKANZROSA-N |
| SMILES | COC(=O)/C=C/C1=C(C=C(C=C1)Cl)F |
Computed by PubChem (NCBI)