Products 261762-89-4

CAS 261762-89-4 is the registry number for 2-Chloro-6-fluoro-3-methylcinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(2-chloro-6-fluoro-3-methylphenyl)prop-2-enoic acid (CAS 261762-89-4) is a chemical compound with the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. IUPAC name: 3-(2-chloro-6-fluoro-3-methylphenyl)prop-2-enoic acid. InChIKey: XURAOUQFLKLYBV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClFO2
Molecular weight214.62 g/mol
IUPAC name3-(2-chloro-6-fluoro-3-methylphenyl)prop-2-enoic acid
InChIKeyXURAOUQFLKLYBV-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)F)C=CC(=O)O)Cl

Computed by PubChem (NCBI)