CAS 2055841-07-9 appears in our catalog under these names: (1R,2R)-Rel-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid, 95%, (1R,2R)-rel-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid, 97%, 2–(4–chloro–3–fluorophenyl)cyclopropane–1–carboxylic acid, Cyclopropanecarboxylic acid, 2-(4-chloro-3-fluorophenyl)-, (1R,2R)-rel-, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 500mg.
Trans-(1R,2R)-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 2055841-07-9) is a chemical compound with the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. IUPAC name: trans-(1R,2R)-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: WLBMRAWVMMPUAI-NKWVEPMBSA-N.
| Molecular formula | C10H8ClFO2 |
|---|---|
| Molecular weight | 214.62 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WLBMRAWVMMPUAI-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)