CAS 122008-78-0 appears in our catalog under these names: Cyhalofop, 95%, Cyhalofop, >95% (HPLC), Cyhalofop, 98%, Cyhalofop, Cyhalofop (free acid). Offered by: Combi-blocks, TRC, AmBeed, Dr. Ehrenstorfer, TargetMol. Available pack sizes: 100mg, 500mg, 250mg, 50mg, 1g, 25mg, 5mg, 10mg.
(2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoic acid (CAS 122008-78-0) is a chemical compound with the molecular formula C16H12FNO4 and a molecular weight of 301.27 g/mol. IUPAC name: (2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoic acid. InChIKey: ROBSGBGTWRRYSK-SNVBAGLBSA-N.
| Molecular formula | C16H12FNO4 |
|---|---|
| Molecular weight | 301.27 g/mol |
| IUPAC name | (2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoic acid |
| InChIKey | ROBSGBGTWRRYSK-SNVBAGLBSA-N |
| SMILES | C[C@H](C(=O)O)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)C#N)F |
Computed by PubChem (NCBI)