cas: 168706-29-4 — see every product listed under this CAS number, including other names
Cynandione A, 99.62% ,, 99.62% , (CAS 168706-29-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13F2FG-1mg |
| cas | 168706-29-4 |
| size | 1mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 3784.40 Pln | |
| Chemat | 5mg | 8334.80 Pln | |
| Chemat | 25mg | 13451.60 Pln | |
| Chemat | 50mg | 16605.20 Pln | |
| Chemat | 100mg | 21232.40 Pln |
| purity | 99.62% , |
|---|---|
| delivery time | 3 weeks |
1-[3-(2-acetyl-3,6-dihydroxyphenyl)-2,4-dihydroxyphenyl]ethanone (CAS 168706-29-4) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 1-[3-(2-acetyl-3,6-dihydroxyphenyl)-2,4-dihydroxyphenyl]ethanone. InChIKey: DYQDHRLBSZIKEM-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 1-[3-(2-acetyl-3,6-dihydroxyphenyl)-2,4-dihydroxyphenyl]ethanone |
| InChIKey | DYQDHRLBSZIKEM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)O)C2=C(C=CC(=C2C(=O)C)O)O)O |
Computed by PubChem (NCBI)