Products 3466-15-7
CAS 3466-15-7 appears in our catalog under these names: Cyperotundone, Cyperotundone/ 98.99% (existing batch purity), (+)-Cyperotundone, 98%, 98%, Cyperotundone, 98.0%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 250mg, 25 mg.
(1R,7R,10R)-4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-3-one (CAS 3466-15-7) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (1R,7R,10R)-4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-3-one. InChIKey: GIGKXOAUYMWORB-OSQNNJELSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (1R,7R,10R)-4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-3-one |
| InChIKey | GIGKXOAUYMWORB-OSQNNJELSA-N |
| SMILES | C[C@@H]1CC[C@@H]2CC3=C(C(=O)C[C@]13C2(C)C)C |
Computed by PubChem (NCBI)