CAS 14091-12-4 appears in our catalog under these names: 3-Chloro-DL-Phenylalanine, D,L-3-Chlorophenylalanine/ 99%. Offered by: Creative Peptides, Chemat. Available pack sizes: on request, 25g, 5g.
2-amino-3-(3-chlorophenyl)propanoic acid (CAS 14091-12-4) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2-amino-3-(3-chlorophenyl)propanoic acid. InChIKey: JJDJLFDGCUYZMN-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 2-amino-3-(3-chlorophenyl)propanoic acid |
| InChIKey | JJDJLFDGCUYZMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC(C(=O)O)N |
Computed by PubChem (NCBI)