Products 1184991-14-7
CAS 1184991-14-7 appears in our catalog under these names: Clofibric Acid-d4, Clofibric-D4 Acid, >95% (HPLC), Clofibric-d4 Acid (4-chlorophenyl-d4), 98 atom % D, min 98% Chemical Purity, Clofibric Acid–d4, D4-Clofibric acid, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, CDN, GLPBio, TargetMol. Available pack sizes: on request, 1mg, 2,5mg, 5mg, 0,05g, 0,01g, 10mg, 500ug.
2-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-2-methylpropanoic acid (CAS 1184991-14-7) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 218.67 g/mol. IUPAC name: 2-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-2-methylpropanoic acid. InChIKey: TXCGAZHTZHNUAI-LNFUJOGGSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 218.67 g/mol |
| IUPAC name | 2-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-2-methylpropanoic acid |
| InChIKey | TXCGAZHTZHNUAI-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OC(C)(C)C(=O)O)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)
Synonyms:
Clofibric-d4 Acid, Clofibric acid-d4, 2-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-2-methylpropanoic acid, Clofibric-d4 Acid (4-chlorophenyl-d4), orb1738175, 2-{[4-Chloro(~2~H_4_)phenyl]oxy}-2-methylpropanoic acid, 2-[4-chloro(2,3,5,6-?H?)phenoxy]-2-methylpropanoic acid, 2-(4-chloro-2,3,5,6-tetradeuterio-phenoxy)-2-methyl-propanoic acid