CAS 1202864-50-3 appears in our catalog under these names: Atenolol-d7, Atenolol-d7, >95% (HPLC), (±)-Atenolol-d7 (iso-propyl-d7), 98 atom % D, min 98% Chemical Purity, (±)–Atenolol–d7, ATENOLOL-D<I/7>. Offered by: Chemat Brand, TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 100mg, 10mg, 50mg, 0,05g, 0,01g, 1mg, 25mg.
2-[4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide (CAS 1202864-50-3) is a chemical compound with the molecular formula C14H22N2O3 and a molecular weight of 273.38 g/mol. IUPAC name: 2-[4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide. InChIKey: METKIMKYRPQLGS-SVMCCORHSA-N.
| Molecular formula | C14H22N2O3 |
|---|---|
| Molecular weight | 273.38 g/mol |
| IUPAC name | 2-[4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide |
| InChIKey | METKIMKYRPQLGS-SVMCCORHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C=C1)CC(=O)N)O |
Computed by PubChem (NCBI)