CAS 2242470-43-3 appears in our catalog under these names: DCZ0415/ 99.1% (existing batch purity), DCZ0415, 2-(4-(Pyridin-4-ylmethyl)phenyl)-4,4a,5,5a,6,6a-hexahydro-4,6-ethenocyclopropa[f]isoindole-1,3(2H,3aH)-dione, 99.95% ,, 99.95% ,, DCZ0415, 99.81%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg.
4-[4-(pyridin-4-ylmethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (CAS 2242470-43-3) is a chemical compound with the molecular formula C23H20N2O2 and a molecular weight of 356.4 g/mol. IUPAC name: 4-[4-(pyridin-4-ylmethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione. InChIKey: LOXMLWHUIONWMI-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O2 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 4-[4-(pyridin-4-ylmethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| InChIKey | LOXMLWHUIONWMI-UHFFFAOYSA-N |
| SMILES | C1C2C1C3C=CC2C4C3C(=O)N(C4=O)C5=CC=C(C=C5)CC6=CC=NC=C6 |
Computed by PubChem (NCBI)