cas: 120157-95-1 — see every product listed under this CAS number, including other names
DIDEUTERO TERT-BUTYL 4-CHLOROBENZYLCARBAMATE, 97% (CAS 120157-95-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F530429-100MG |
| cas | 120157-95-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 565.44 Pln | |
| Fluorochem | 250mg | 955.93 Pln | |
| Fluorochem | 1g | 1815.00 Pln | |
| Fluorochem | 5g | 6375.90 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(4-chlorophenyl)methyl]carbamate (CAS 120157-95-1) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: tert-butyl N-[(4-chlorophenyl)methyl]carbamate. InChIKey: DWKFLKALAMAVJY-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | tert-butyl N-[(4-chlorophenyl)methyl]carbamate |
| InChIKey | DWKFLKALAMAVJY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)