cas: 37784-67-1 — see every product listed under this CAS number, including other names
DIETHYL (3-THIENYL)MALONATE, 95%, 95% (CAS 37784-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CJ15-100mg |
| cas | 37784-67-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 822.80 Pln | |
| Chemat | 250mg | 1322.00 Pln | |
| Chemat | 1g | 2848.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Diethyl 2-thiophen-3-ylpropanedioate (CAS 37784-67-1) is a chemical compound with the molecular formula C11H14O4S and a molecular weight of 242.29 g/mol. IUPAC name: diethyl 2-thiophen-3-ylpropanedioate. InChIKey: AURROROYQPIDRG-UHFFFAOYSA-N.
| Molecular formula | C11H14O4S |
|---|---|
| Molecular weight | 242.29 g/mol |
| IUPAC name | diethyl 2-thiophen-3-ylpropanedioate |
| InChIKey | AURROROYQPIDRG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CSC=C1)C(=O)OCC |
Computed by PubChem (NCBI)