Products 104872-42-6

CAS 104872-42-6 appears in our catalog under these names: DOTMA E–isomer, DOTMA/ 98.22% (existing batch purity), DOTMA 98%, DOTMA, N,N,N-Trimethyl-2,3-bis(octadec-9-en-1-yloxy)propan-1-aminium chloride, 98%, 98%. Offered by: GLPBio, TargetMol, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 1g, 200mg, 2g, 25mg, 50mg, 500mg, 5mg.

Structural formula: {0} (CAS {1})

2,3-bis[(E)-octadec-9-enoxy]propyl-trimethylazanium chloride (CAS 104872-42-6) is a chemical compound with the molecular formula C42H84ClNO2 and a molecular weight of 670.6 g/mol. IUPAC name: 2,3-bis[(E)-octadec-9-enoxy]propyl-trimethylazanium chloride. InChIKey: LDGWQMRUWMSZIU-AFLLVNNISA-M.

Identity
Molecular formulaC42H84ClNO2
Molecular weight670.6 g/mol
IUPAC name2,3-bis[(E)-octadec-9-enoxy]propyl-trimethylazanium chloride
InChIKeyLDGWQMRUWMSZIU-AFLLVNNISA-M
SMILESCCCCCCCC/C=C/CCCCCCCCOCC(C[N+](C)(C)C)OCCCCCCCC/C=C/CCCCCCCC.[Cl-]

Computed by PubChem (NCBI)